C23H23BrClN3 — CID 74736571
4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(3-chlorophenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 74736571) has the molecular formula C23H23BrClN3 and a molecular weight of 456.82 g/mol. Its IUPAC name is 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(3-chlorophenyl)methyl]cyclopent-2-en-1-amine.
| Compound Name | 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(3-chlorophenyl)methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 74736571 |
| Molecular Formula | C23H23BrClN3 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(3-chlorophenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2cccc(Br)c2)c(C)c1C1C=CC(NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H23BrClN3/c1-15-23(16(2)28(27-15)22-8-4-6-19(24)13-22)18-9-10-21(12-18)26-14-17-5-3-7-20(25)11-17/h3-11,13,18,21,26H,12,14H2,1-2H3 |
| InChIKey | CNGNHJGDALEFMO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|