C21H23N5 — CID 44716529
(1S,4S)-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(pyridin-2-ylmethyl)cyclopent-2-en-1-amine (PubChem CID 44716529) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is (1S,4S)-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(pyridin-2-ylmethyl)cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(pyridin-2-ylmethyl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 44716529 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (1S,4S)-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)-N-(pyridin-2-ylmethyl)cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1[C@@H]1C=C[C@@H](NCc2ccccn2)C1 |
| InChI | InChI=1S/C21H23N5/c1-15-21(16(2)26(25-15)20-8-4-6-12-23-20)17-9-10-18(13-17)24-14-19-7-3-5-11-22-19/h3-12,17-18,24H,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | AYZHICODCAJKKH-QZTJIDSGSA-N |
| XLogP | 3.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|