C22H24N5O2- — CID 163176271
N-[2-[3,5-dimethyl-4-[4-(pyridin-2-ylmethylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]phenyl]-N-oxidohydroxylamine (PubChem CID 163176271) has the molecular formula C22H24N5O2- and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[2-[3,5-dimethyl-4-[4-(pyridin-2-ylmethylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[2-[3,5-dimethyl-4-[4-(pyridin-2-ylmethylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163176271 |
| Molecular Formula | C22H24N5O2- |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[2-[3,5-dimethyl-4-[4-(pyridin-2-ylmethylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]phenyl]-N-oxidohydroxylamine |
| SMILES | Cc1nn(-c2ccccc2N([O-])O)c(C)c1C1C=CC(NCc2ccccn2)C1 |
| InChI | InChI=1S/C22H24N5O2/c1-15-22(16(2)26(25-15)20-8-3-4-9-21(20)27(28)29)17-10-11-18(13-17)24-14-19-7-5-6-12-23-19/h3-12,17-18,24,28H,13-14H2,1-2H3/q-1 |
| InChIKey | GAYHPBHHRDJVSH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|