C22H24N4O4S — CID 163136173
2-[4-[(1S,4S)-4-(benzenesulfonamido)cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163136173) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[4-[(1S,4S)-4-(benzenesulfonamido)cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[4-[(1S,4S)-4-(benzenesulfonamido)cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163136173 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[4-[(1S,4S)-4-(benzenesulfonamido)cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1nn(-c2ccccc2[NH+]([O-])O)c(C)c1[C@@H]1C=C[C@@H](NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H24N4O4S/c1-15-22(16(2)25(23-15)20-10-6-7-11-21(20)26(27)28)17-12-13-18(14-17)24-31(29,30)19-8-4-3-5-9-19/h3-13,17-18,24,26-27H,14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | IANAIBWTLDMGDB-QZTJIDSGSA-N |
| XLogP | 2.28 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|