C24H24N5O2- — CID 163148413
3-[[[(1S,4S)-4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile (PubChem CID 163148413) has the molecular formula C24H24N5O2- and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[[[(1S,4S)-4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[(1S,4S)-4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 163148413 |
| Molecular Formula | C24H24N5O2- |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[[[(1S,4S)-4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile |
| SMILES | Cc1nn(-c2ccccc2N([O-])O)c(C)c1[C@@H]1C=C[C@@H](NCc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C24H24N5O2/c1-16-24(17(2)28(27-16)22-8-3-4-9-23(22)29(30)31)20-10-11-21(13-20)26-15-19-7-5-6-18(12-19)14-25/h3-12,20-21,26,30H,13,15H2,1-2H3/q-1/t20-,21-/m1/s1 |
| InChIKey | RAZZFYPFFWAZPR-NHCUHLMSSA-N |
| XLogP | 4.26 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|