C24H25N4O4- — CID 163156208
[4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-[3-[hydroxy(oxido)amino]phenyl]carbamate (PubChem CID 163156208) has the molecular formula C24H25N4O4- and a molecular weight of 433.49 g/mol. Its IUPAC name is [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-[3-[hydroxy(oxido)amino]phenyl]carbamate.
| Compound Name | [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-[3-[hydroxy(oxido)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 163156208 |
| Molecular Formula | C24H25N4O4- |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-[3-[hydroxy(oxido)amino]phenyl]carbamate |
| SMILES | Cc1ccccc1-n1nc(C)c(C2C=CC(OC(=O)Nc3cccc(N([O-])O)c3)C2)c1C |
| InChI | InChI=1S/C24H25N4O4/c1-15-7-4-5-10-22(15)27-17(3)23(16(2)26-27)18-11-12-21(13-18)32-24(29)25-19-8-6-9-20(14-19)28(30)31/h4-12,14,18,21,30H,13H2,1-3H3,(H,25,29)/q-1 |
| InChIKey | LELOUSOYCXCWRZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|