C26H29N3O3 — CID 74506422
[4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(1-phenylethyl)carbamate (PubChem CID 74506422) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(1-phenylethyl)carbamate.
| Compound Name | [4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(1-phenylethyl)carbamate |
|---|---|
| PubChem CID | 74506422 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(1-phenylethyl)carbamate |
| SMILES | COc1ccc(-n2nc(C)c(C3C=CC(OC(=O)NC(C)c4ccccc4)C3)c2C)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-17(20-8-6-5-7-9-20)27-26(30)32-24-13-10-21(16-24)25-18(2)28-29(19(25)3)22-11-14-23(31-4)15-12-22/h5-15,17,21,24H,16H2,1-4H3,(H,27,30) |
| InChIKey | RXMOTAGYNKNGMD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|