C24H22F3N3O2 — CID 40777732
[(1S,4R)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 40777732) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is [(1S,4R)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(1S,4R)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 40777732 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [(1S,4R)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@H]1C=C[C@@H](OC(=O)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H22F3N3O2/c1-15-22(16(2)30(29-15)20-9-4-3-5-10-20)17-11-12-21(13-17)32-23(31)28-19-8-6-7-18(14-19)24(25,26)27/h3-12,14,17,21H,13H2,1-2H3,(H,28,31)/t17-,21+/m0/s1 |
| InChIKey | DGCHHVJOJCHXOT-LAUBAEHRSA-N |
| XLogP | 6.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|