C24H24FN3O3 — CID 40777690
[(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(3-fluorophenyl)carbamate (PubChem CID 40777690) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is [(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 40777690 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(3-fluorophenyl)carbamate |
| SMILES | COc1ccc(-n2nc(C)c([C@H]3C=C[C@@H](OC(=O)Nc4cccc(F)c4)C3)c2C)cc1 |
| InChI | InChI=1S/C24H24FN3O3/c1-15-23(16(2)28(27-15)20-8-11-21(30-3)12-9-20)17-7-10-22(13-17)31-24(29)26-19-6-4-5-18(25)14-19/h4-12,14,17,22H,13H2,1-3H3,(H,26,29)/t17-,22+/m0/s1 |
| InChIKey | AWCHNZKGPIGVOG-HTAPYJJXSA-N |
| XLogP | 5.30 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|