C24H26N4OS — CID 162915360
1-[(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylthiourea (PubChem CID 162915360) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 1-[(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylthiourea.
| Compound Name | 1-[(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 162915360 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(1S,4R)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylthiourea |
| SMILES | COc1ccc(-n2nc(C)c([C@H]3C=C[C@@H](NC(=S)Nc4ccccc4)C3)c2C)cc1 |
| InChI | InChI=1S/C24H26N4OS/c1-16-23(17(2)28(27-16)21-11-13-22(29-3)14-12-21)18-9-10-20(15-18)26-24(30)25-19-7-5-4-6-8-19/h4-14,18,20H,15H2,1-3H3,(H2,25,26,30)/t18-,20+/m0/s1 |
| InChIKey | GZKPOXAMTVFQLE-AZUAARDMSA-N |
| XLogP | 4.90 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|