C24H26N5O4- — CID 163181226
1-[4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(4-methoxyphenyl)urea (PubChem CID 163181226) has the molecular formula C24H26N5O4- and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-[4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 163181226 |
| Molecular Formula | C24H26N5O4- |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[4-[1-[2-[hydroxy(oxido)amino]phenyl]-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC2C=CC(c3c(C)nn(-c4ccccc4N([O-])O)c3C)C2)cc1 |
| InChI | InChI=1S/C24H26N5O4/c1-15-23(16(2)28(27-15)21-6-4-5-7-22(21)29(31)32)17-8-9-19(14-17)26-24(30)25-18-10-12-20(33-3)13-11-18/h4-13,17,19,31H,14H2,1-3H3,(H2,25,26,30)/q-1 |
| InChIKey | AJLHYRSCNPJWDO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|