C22H30N4OS — CID 74451201
1-[4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(2-methylpropyl)thiourea (PubChem CID 74451201) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-[4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 74451201 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-[4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1ccc(-n2nc(C)c(C3C=CC(NC(=S)NCC(C)C)C3)c2C)cc1 |
| InChI | InChI=1S/C22H30N4OS/c1-14(2)13-23-22(28)24-18-7-6-17(12-18)21-15(3)25-26(16(21)4)19-8-10-20(27-5)11-9-19/h6-11,14,17-18H,12-13H2,1-5H3,(H2,23,24,28) |
| InChIKey | BXNGMGCFSJHSHG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|