C26H36N4O — CID 162918310
1-cyclohexyl-3-[(1S,4R)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]urea (PubChem CID 162918310) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S,4R)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(1S,4R)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 162918310 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-cyclohexyl-3-[(1S,4R)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]urea |
| SMILES | Cc1nn(-c2ccc(C(C)C)cc2)c(C)c1[C@H]1C=C[C@@H](NC(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C26H36N4O/c1-17(2)20-11-14-24(15-12-20)30-19(4)25(18(3)29-30)21-10-13-23(16-21)28-26(31)27-22-8-6-5-7-9-22/h10-15,17,21-23H,5-9,16H2,1-4H3,(H2,27,28,31)/t21-,23+/m0/s1 |
| InChIKey | JGKWYIAGDVAHKD-JTHBVZDNSA-N |
| XLogP | 5.66 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|