C25H26ClN3O2 — CID 26743419
N-[(1S,4S)-4-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-2-phenoxyacetamide (PubChem CID 26743419) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is N-[(1S,4S)-4-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-2-phenoxyacetamide.
| Compound Name | N-[(1S,4S)-4-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 26743419 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(1S,4S)-4-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]-2-phenoxyacetamide |
| SMILES | Cc1ccc(-n2nc(C)c([C@@H]3C=C[C@@H](NC(=O)COc4ccccc4)C3)c2C)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O2/c1-16-9-12-21(14-23(16)26)29-18(3)25(17(2)28-29)19-10-11-20(13-19)27-24(30)15-31-22-7-5-4-6-8-22/h4-12,14,19-20H,13,15H2,1-3H3,(H,27,30)/t19-,20-/m1/s1 |
| InChIKey | SAGZQSYGEJIXQV-WOJBJXKFSA-N |
| XLogP | 5.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|