C21H25N3O3S — CID 163084866
2-[2-[[(1S,4R)-4-(1-benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 163084866) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-[2-[[(1S,4R)-4-(1-benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[(1S,4R)-4-(1-benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 163084866 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[2-[[(1S,4R)-4-(1-benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1[C@H]1C=C[C@@H](NC(=O)CSCC(=O)O)C1 |
| InChI | InChI=1S/C21H25N3O3S/c1-14-21(15(2)24(23-14)11-16-6-4-3-5-7-16)17-8-9-18(10-17)22-19(25)12-28-13-20(26)27/h3-9,17-18H,10-13H2,1-2H3,(H,22,25)(H,26,27)/t17-,18+/m0/s1 |
| InChIKey | YPMFRPKYQQXEAQ-ZWKOTPCHSA-N |
| XLogP | 2.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|