C23H24ClN3 — CID 74736545
N-[(3-chlorophenyl)methyl]-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-amine (PubChem CID 74736545) has the molecular formula C23H24ClN3 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 74736545 |
| Molecular Formula | C23H24ClN3 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C1C=CC(NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H24ClN3/c1-16-23(17(2)27(26-16)22-9-4-3-5-10-22)19-11-12-21(14-19)25-15-18-7-6-8-20(24)13-18/h3-13,19,21,25H,14-15H2,1-2H3 |
| InChIKey | ZNWWUTWNGDCOIB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|