C21H24ClN5 — CID 111177128
1-[(3-chlorophenyl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine (PubChem CID 111177128) has the molecular formula C21H24ClN5 and a molecular weight of 381.91 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111177128 |
| Molecular Formula | C21H24ClN5 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cccc(Cl)c1)NCc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H24ClN5/c1-15-20(16(2)27(26-15)19-10-5-4-6-11-19)14-25-21(23-3)24-13-17-8-7-9-18(22)12-17/h4-12H,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | MCFMPICDDQBJBJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|