C24H27IN6O — CID 111553874
1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111553874) has the molecular formula C24H27IN6O and a molecular weight of 542.43 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553874 |
| Molecular Formula | C24H27IN6O |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1c(C)nn(-c2ccccc2)c1C.I |
| InChI | InChI=1S/C24H26N6O.HI/c1-17-22(18(2)30(29-17)21-12-8-5-9-13-21)15-27-24(25-3)26-14-20-16-31-23(28-20)19-10-6-4-7-11-19;/h4-13,16H,14-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | MAQJMMKBPCFEJV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|