C23H24IN5OS — CID 111551771
2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111551771) has the molecular formula C23H24IN5OS and a molecular weight of 545.45 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111551771 |
| Molecular Formula | C23H24IN5OS |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1sc(-c2ccccc2)nc1C.I |
| InChI | InChI=1S/C23H23N5OS.HI/c1-16-20(30-22(27-16)18-11-7-4-8-12-18)14-26-23(24-2)25-13-19-15-29-21(28-19)17-9-5-3-6-10-17;/h3-12,15H,13-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | AHDIMVFBJIMOGY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|