C17H25IN4S — CID 110966691
1-tert-butyl-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 110966691) has the molecular formula C17H25IN4S and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-tert-butyl-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110966691 |
| Molecular Formula | C17H25IN4S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-tert-butyl-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1sc(-c2ccccc2)nc1C)NC(C)(C)C.I |
| InChI | InChI=1S/C17H24N4S.HI/c1-12-14(11-19-16(18-5)21-17(2,3)4)22-15(20-12)13-9-7-6-8-10-13;/h6-10H,11H2,1-5H3,(H2,18,19,21);1H |
| InChIKey | QRJUMRGLNKEJPU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|