C22H27IN4O2S — CID 111202691
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111202691) has the molecular formula C22H27IN4O2S and a molecular weight of 538.46 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111202691 |
| Molecular Formula | C22H27IN4O2S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC)c1)NCc1sc(-c2ccccc2)nc1C.I |
| InChI | InChI=1S/C22H26N4O2S.HI/c1-15-20(29-21(26-15)17-8-6-5-7-9-17)14-25-22(23-2)24-13-16-10-11-18(27-3)19(12-16)28-4;/h5-12H,13-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | YPCIXKVSXRSTAP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|