C21H27N3O2 — CID 163147086
[4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-propylcarbamate (PubChem CID 163147086) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-propylcarbamate.
| Compound Name | [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 163147086 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)OC1C=CC(c2c(C)nn(-c3ccccc3C)c2C)C1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-12-22-21(25)26-18-11-10-17(13-18)20-15(3)23-24(16(20)4)19-9-7-6-8-14(19)2/h6-11,17-18H,5,12-13H2,1-4H3,(H,22,25) |
| InChIKey | LZKQBHFJUGANLT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|