C23H24FN4O2- — CID 163170318
N-[2-[4-[(1S,4S)-4-[(4-fluorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenyl]-N-oxidohydroxylamine (PubChem CID 163170318) has the molecular formula C23H24FN4O2- and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[2-[4-[(1S,4S)-4-[(4-fluorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[2-[4-[(1S,4S)-4-[(4-fluorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163170318 |
| Molecular Formula | C23H24FN4O2- |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-[4-[(1S,4S)-4-[(4-fluorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenyl]-N-oxidohydroxylamine |
| SMILES | Cc1nn(-c2ccccc2N([O-])O)c(C)c1[C@@H]1C=C[C@@H](NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H24FN4O2/c1-15-23(16(2)27(26-15)21-5-3-4-6-22(21)28(29)30)18-9-12-20(13-18)25-14-17-7-10-19(24)11-8-17/h3-12,18,20,25,29H,13-14H2,1-2H3/q-1/t18-,20-/m1/s1 |
| InChIKey | DBQARSYYRCEZCN-UYAOXDASSA-N |
| XLogP | 4.52 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|