C26H32N4O2 — CID 163128003
2-[3,5-dimethyl-4-[(1R,4S)-4-[(4-propan-2-ylphenyl)methylamino]cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163128003) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[(1R,4S)-4-[(4-propan-2-ylphenyl)methylamino]cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[3,5-dimethyl-4-[(1R,4S)-4-[(4-propan-2-ylphenyl)methylamino]cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163128003 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[3,5-dimethyl-4-[(1R,4S)-4-[(4-propan-2-ylphenyl)methylamino]cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1nn(-c2ccccc2[NH+]([O-])O)c(C)c1[C@H]1C=C[C@@H](NCc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C26H32N4O2/c1-17(2)21-11-9-20(10-12-21)16-27-23-14-13-22(15-23)26-18(3)28-29(19(26)4)24-7-5-6-8-25(24)30(31)32/h5-14,17,22-23,27,30-31H,15-16H2,1-4H3/t22-,23+/m0/s1 |
| InChIKey | FASKWVBKYNHYKX-XZOQPEGZSA-N |
| XLogP | 4.22 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|