C22H23N5S — CID 74736473
1-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]-3-phenylthiourea (PubChem CID 74736473) has the molecular formula C22H23N5S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]-3-phenylthiourea.
| Compound Name | 1-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 74736473 |
| Molecular Formula | C22H23N5S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]-3-phenylthiourea |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1C1C=CC(NC(=S)Nc2ccccc2)C1 |
| InChI | InChI=1S/C22H23N5S/c1-15-21(16(2)27(26-15)20-10-6-7-13-23-20)17-11-12-19(14-17)25-22(28)24-18-8-4-3-5-9-18/h3-13,17,19H,14H2,1-2H3,(H2,24,25,28) |
| InChIKey | AGSZLIAGVQOCAV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|