C24H27N5O — CID 74734859
4-(dimethylamino)-N-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]benzamide (PubChem CID 74734859) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]benzamide |
|---|---|
| PubChem CID | 74734859 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-(dimethylamino)-N-[4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-yl]benzamide |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1C1C=CC(NC(=O)c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C24H27N5O/c1-16-23(17(2)29(27-16)22-7-5-6-14-25-22)19-8-11-20(15-19)26-24(30)18-9-12-21(13-10-18)28(3)4/h5-14,19-20H,15H2,1-4H3,(H,26,30) |
| InChIKey | MXUIMNUABCUNRM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|