C21H24N4O3 — CID 74734998
[4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(4-methoxyphenyl)carbamate (PubChem CID 74734998) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 74734998 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl] N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC2C=CC(c3c(C)nn(CCC#N)c3C)C2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-20(15(2)25(24-14)12-4-11-22)16-5-8-19(13-16)28-21(26)23-17-6-9-18(27-3)10-7-17/h5-10,16,19H,4,12-13H2,1-3H3,(H,23,26) |
| InChIKey | QPXNFMPFFQTZPD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|