C19H20N4OS — CID 99802982
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(3-methoxyphenyl)thiourea (PubChem CID 99802982) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 99802982 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C19H20N4OS/c1-13-18(14(2)23(22-13)16-9-5-4-6-10-16)21-19(25)20-15-8-7-11-17(12-15)24-3/h4-12H,1-3H3,(H2,20,21,25) |
| InChIKey | WPYZTXCTLHCMCV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|