C12H20O3 — CID 139191420
(1R,3aR,4S,6R,8aS)-1,4-dimethyl-2,3,3a,4,5,6-hexahydroazulene-1,6,8a-triol (PubChem CID 139191420) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1R,3aR,4S,6R,8aS)-1,4-dimethyl-2,3,3a,4,5,6-hexahydroazulene-1,6,8a-triol.
| Compound Name | (1R,3aR,4S,6R,8aS)-1,4-dimethyl-2,3,3a,4,5,6-hexahydroazulene-1,6,8a-triol |
|---|---|
| PubChem CID | 139191420 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (1R,3aR,4S,6R,8aS)-1,4-dimethyl-2,3,3a,4,5,6-hexahydroazulene-1,6,8a-triol |
| SMILES | C[C@H]1C[C@@H](O)C=C[C@]2(O)[C@@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C12H20O3/c1-8-7-9(13)3-6-12(15)10(8)4-5-11(12,2)14/h3,6,8-10,13-15H,4-5,7H2,1-2H3/t8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | CCSQIEUOORRBIB-HGCLJGPKSA-N |
| XLogP | 0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|