C14H23N — CID 142585035
N-(2,5-dimethylcyclohepta-1,3,6-trien-1-yl)methanimine;methane;prop-1-ene (PubChem CID 142585035) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohepta-1,3,6-trien-1-yl)methanimine;methane;prop-1-ene.
| Compound Name | N-(2,5-dimethylcyclohepta-1,3,6-trien-1-yl)methanimine;methane;prop-1-ene |
|---|---|
| PubChem CID | 142585035 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-(2,5-dimethylcyclohepta-1,3,6-trien-1-yl)methanimine;methane;prop-1-ene |
| SMILES | C.C=CC.C=NC1=C(C)C=CC(C)C=C1 |
| InChI | InChI=1S/C10H13N.C3H6.CH4/c1-8-4-6-9(2)10(11-3)7-5-8;1-3-2;/h4-8H,3H2,1-2H3;3H,1H2,2H3;1H4 |
| InChIKey | JDMRKYQCHGPSJM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|