C10H12OV — CID 174806990
(4,5,6-trimethylcyclohexa-2,4-dien-1-ylidene)methanone;vanadium (PubChem CID 174806990) has the molecular formula C10H12OV and a molecular weight of 199.15 g/mol. Its IUPAC name is (4,5,6-trimethylcyclohexa-2,4-dien-1-ylidene)methanone;vanadium.
| Compound Name | (4,5,6-trimethylcyclohexa-2,4-dien-1-ylidene)methanone;vanadium |
|---|---|
| PubChem CID | 174806990 |
| Molecular Formula | C10H12OV |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | (4,5,6-trimethylcyclohexa-2,4-dien-1-ylidene)methanone;vanadium |
| SMILES | CC1=C(C)C(C)C(=C=O)C=C1.[V] |
| InChI | InChI=1S/C10H12O.V/c1-7-4-5-10(6-11)9(3)8(7)2;/h4-5,9H,1-3H3; |
| InChIKey | QTCWLKRFAMBUHO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|