C8H8O2 — CID 174435987
(6-hydroxy-3-methylcyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 174435987) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is (6-hydroxy-3-methylcyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | (6-hydroxy-3-methylcyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 174435987 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (6-hydroxy-3-methylcyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | CC1=CC(=C=O)C(O)C=C1 |
| InChI | InChI=1S/C8H8O2/c1-6-2-3-8(10)7(4-6)5-9/h2-4,8,10H,1H3 |
| InChIKey | ALOPKSWSNGECOH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|