C8H8O — CID 154163328
6-ethenylidenecyclohexa-2,4-dien-1-ol (PubChem CID 154163328) has the molecular formula C8H8O and a molecular weight of 120.15 g/mol. Its IUPAC name is 6-ethenylidenecyclohexa-2,4-dien-1-ol.
| Compound Name | 6-ethenylidenecyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 154163328 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 6-ethenylidenecyclohexa-2,4-dien-1-ol |
| SMILES | C=C=C1C=CC=CC1O |
| InChI | InChI=1S/C8H8O/c1-2-7-5-3-4-6-8(7)9/h3-6,8-9H,1H2 |
| InChIKey | XZGDZDVZPGNVSB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |