C14H14O2 — CID 146179006
3-(4-methylphenyl)cyclohepta-2,4,6-triene-1,2-diol (PubChem CID 146179006) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-(4-methylphenyl)cyclohepta-2,4,6-triene-1,2-diol.
| Compound Name | 3-(4-methylphenyl)cyclohepta-2,4,6-triene-1,2-diol |
|---|---|
| PubChem CID | 146179006 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-(4-methylphenyl)cyclohepta-2,4,6-triene-1,2-diol |
| SMILES | Cc1ccc(C2=C(O)C(O)C=CC=C2)cc1 |
| InChI | InChI=1S/C14H14O2/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(15)14(12)16/h2-9,13,15-16H,1H3 |
| InChIKey | NRIRWHICFLVKQV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |