C19H16 — CID 144569451
(4aE,6Z)-5-(4-methylphenyl)-9,10-didehydro-8,10a-dihydrobenzo[8]annulene (PubChem CID 144569451) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is (4aE,6Z)-5-(4-methylphenyl)-9,10-didehydro-8,10a-dihydrobenzo[8]annulene.
| Compound Name | (4aE,6Z)-5-(4-methylphenyl)-9,10-didehydro-8,10a-dihydrobenzo[8]annulene |
|---|---|
| PubChem CID | 144569451 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (4aE,6Z)-5-(4-methylphenyl)-9,10-didehydro-8,10a-dihydrobenzo[8]annulene |
| SMILES | Cc1ccc(C2=C3\C=CC=CC3C#CC/C=C\2)cc1 |
| InChI | InChI=1S/C19H16/c1-15-11-13-17(14-12-15)19-9-4-2-3-7-16-8-5-6-10-18(16)19/h4-6,8-14,16H,2H2,1H3/b9-4-,19-18+ |
| InChIKey | AKJJQVHFOSEDTL-JKPAGOEPSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|