C21H22 — CID 142553617
7-methyl-2-phenylcyclohepta-1,3,5-triene;toluene (PubChem CID 142553617) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is 7-methyl-2-phenylcyclohepta-1,3,5-triene;toluene.
| Compound Name | 7-methyl-2-phenylcyclohepta-1,3,5-triene;toluene |
|---|---|
| PubChem CID | 142553617 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 7-methyl-2-phenylcyclohepta-1,3,5-triene;toluene |
| SMILES | CC1C=CC=CC(c2ccccc2)=C1.Cc1ccccc1 |
| InChI | InChI=1S/C14H14.C7H8/c1-12-7-5-6-10-14(11-12)13-8-3-2-4-9-13;1-7-5-3-2-4-6-7/h2-12H,1H3;2-6H,1H3 |
| InChIKey | LKNOBZVIMRVKSB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |