About 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone
1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 130027554) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone.
Analyze 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone (CID 130027554) is 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone is C=C1C=CC=CC1C(C)=O.
What is the InChIKey of 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is ABSMTGOLLHRAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6,9H,1H2,2H3.
What are the key properties of 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone?
1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 134.18 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 130027554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).