C10H14 — CID 163513277
5-methylidene-6-propylcyclohexa-1,3-diene (PubChem CID 163513277) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 5-methylidene-6-propylcyclohexa-1,3-diene.
| Compound Name | 5-methylidene-6-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163513277 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 5-methylidene-6-propylcyclohexa-1,3-diene |
| SMILES | C=C1C=CC=CC1CCC |
| InChI | InChI=1S/C10H14/c1-3-6-10-8-5-4-7-9(10)2/h4-5,7-8,10H,2-3,6H2,1H3 |
| InChIKey | DENLMKSBXLWGFJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |