C12H15N3 — CID 174823510
5-methylidene-6-prop-2-enylcyclohexa-1,3-diene;2H-triazole (PubChem CID 174823510) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-methylidene-6-prop-2-enylcyclohexa-1,3-diene;2H-triazole.
| Compound Name | 5-methylidene-6-prop-2-enylcyclohexa-1,3-diene;2H-triazole |
|---|---|
| PubChem CID | 174823510 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5-methylidene-6-prop-2-enylcyclohexa-1,3-diene;2H-triazole |
| SMILES | C=CCC1C=CC=CC1=C.c1cn[nH]n1 |
| InChI | InChI=1S/C10H12.C2H3N3/c1-3-6-10-8-5-4-7-9(10)2;1-2-4-5-3-1/h3-5,7-8,10H,1-2,6H2;1-2H,(H,3,4,5) |
| InChIKey | KCZSNEXKKHDZTR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|