About 1-hex-5-enyl-3aH-indene
1-hex-5-enyl-3aH-indene (PubChem CID 22899034) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-hex-5-enyl-3aH-indene.
Molecular Properties
| Compound Name | 1-hex-5-enyl-3aH-indene |
| PubChem CID | 22899034 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-hex-5-enyl-3aH-indene |
| SMILES | C=CCCCCC1=C2C=CC=CC2C=C1 |
| InChI | InChI=1S/C15H18/c1-2-3-4-5-8-13-11-12-14-9-6-7-10-15(13)14/h2,6-7,9-12,14H,1,3-5,8H2 |
| InChIKey | KFRJLYFMQBTYNE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-5-enyl-3aH-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-5-enyl-3aH-indene?
The IUPAC name of 1-hex-5-enyl-3aH-indene (CID 22899034) is 1-hex-5-enyl-3aH-indene.
What is the SMILES notation for 1-hex-5-enyl-3aH-indene?
The canonical SMILES for 1-hex-5-enyl-3aH-indene is C=CCCCCC1=C2C=CC=CC2C=C1.
What is the InChIKey of 1-hex-5-enyl-3aH-indene?
The InChIKey is KFRJLYFMQBTYNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-2-3-4-5-8-13-11-12-14-9-6-7-10-15(13)14/h2,6-7,9-12,14H,1,3-5,8H2.
What are the key properties of 1-hex-5-enyl-3aH-indene?
1-hex-5-enyl-3aH-indene has a molecular weight of 198.31 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-5-enyl-3aH-indene is sourced from PubChem (CID 22899034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).