About 4-tetradec-13-enylphenol
4-tetradec-13-enylphenol (PubChem CID 157380665) has the molecular formula C20H32O
and a molecular weight of 288.48 g/mol. Its IUPAC name is 4-tetradec-13-enylphenol.
Molecular Properties
| Compound Name | 4-tetradec-13-enylphenol |
| PubChem CID | 157380665 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4-tetradec-13-enylphenol |
| SMILES | C=CCCCCCCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19/h2,15-18,21H,1,3-14H2 |
| InChIKey | QDQVALMKHPPFHR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tetradec-13-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tetradec-13-enylphenol?
The IUPAC name of 4-tetradec-13-enylphenol (CID 157380665) is 4-tetradec-13-enylphenol.
What is the SMILES notation for 4-tetradec-13-enylphenol?
The canonical SMILES for 4-tetradec-13-enylphenol is C=CCCCCCCCCCCCCc1ccc(O)cc1.
What is the InChIKey of 4-tetradec-13-enylphenol?
The InChIKey is QDQVALMKHPPFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19/h2,15-18,21H,1,3-14H2.
What are the key properties of 4-tetradec-13-enylphenol?
4-tetradec-13-enylphenol has a molecular weight of 288.48 g/mol, XLogP of 6.41, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tetradec-13-enylphenol is sourced from PubChem (CID 157380665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).