About 4-hept-5-enylphenol
4-hept-5-enylphenol (PubChem CID 66787200) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-hept-5-enylphenol.
Molecular Properties
| Compound Name | 4-hept-5-enylphenol |
| PubChem CID | 66787200 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-hept-5-enylphenol |
| SMILES | CC=CCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C13H18O/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h2-3,8-11,14H,4-7H2,1H3 |
| InChIKey | LWNWLUGSBRNZCB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hept-5-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hept-5-enylphenol?
The IUPAC name of 4-hept-5-enylphenol (CID 66787200) is 4-hept-5-enylphenol.
What is the SMILES notation for 4-hept-5-enylphenol?
The canonical SMILES for 4-hept-5-enylphenol is CC=CCCCCc1ccc(O)cc1.
What is the InChIKey of 4-hept-5-enylphenol?
The InChIKey is LWNWLUGSBRNZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h2-3,8-11,14H,4-7H2,1H3.
What are the key properties of 4-hept-5-enylphenol?
4-hept-5-enylphenol has a molecular weight of 190.29 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hept-5-enylphenol is sourced from PubChem (CID 66787200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).