About 4-dec-8-enylbenzoic acid
4-dec-8-enylbenzoic acid (PubChem CID 151842838) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-dec-8-enylbenzoic acid.
Molecular Properties
| Compound Name | 4-dec-8-enylbenzoic acid |
| PubChem CID | 151842838 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-dec-8-enylbenzoic acid |
| SMILES | CC=CCCCCCCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H24O2/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19/h2-3,11-14H,4-10H2,1H3,(H,18,19) |
| InChIKey | SHAMUMOJGKTXAY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-dec-8-enylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dec-8-enylbenzoic acid?
The IUPAC name of 4-dec-8-enylbenzoic acid (CID 151842838) is 4-dec-8-enylbenzoic acid.
What is the SMILES notation for 4-dec-8-enylbenzoic acid?
The canonical SMILES for 4-dec-8-enylbenzoic acid is CC=CCCCCCCCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-dec-8-enylbenzoic acid?
The InChIKey is SHAMUMOJGKTXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19/h2-3,11-14H,4-10H2,1H3,(H,18,19).
What are the key properties of 4-dec-8-enylbenzoic acid?
4-dec-8-enylbenzoic acid has a molecular weight of 260.38 g/mol, XLogP of 4.84, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dec-8-enylbenzoic acid is sourced from PubChem (CID 151842838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).