About 4-(4-iodobutyl)benzoic acid
4-(4-iodobutyl)benzoic acid (PubChem CID 86118519) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is 4-(4-iodobutyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(4-iodobutyl)benzoic acid |
| PubChem CID | 86118519 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 4-(4-iodobutyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CCCCI)cc1 |
| InChI | InChI=1S/C11H13IO2/c12-8-2-1-3-9-4-6-10(7-5-9)11(13)14/h4-7H,1-3,8H2,(H,13,14) |
| InChIKey | RBBYJGIUSHQSGD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-iodobutyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-iodobutyl)benzoic acid?
The IUPAC name of 4-(4-iodobutyl)benzoic acid (CID 86118519) is 4-(4-iodobutyl)benzoic acid.
What is the SMILES notation for 4-(4-iodobutyl)benzoic acid?
The canonical SMILES for 4-(4-iodobutyl)benzoic acid is O=C(O)c1ccc(CCCCI)cc1.
What is the InChIKey of 4-(4-iodobutyl)benzoic acid?
The InChIKey is RBBYJGIUSHQSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO2/c12-8-2-1-3-9-4-6-10(7-5-9)11(13)14/h4-7H,1-3,8H2,(H,13,14).
What are the key properties of 4-(4-iodobutyl)benzoic acid?
4-(4-iodobutyl)benzoic acid has a molecular weight of 304.13 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-iodobutyl)benzoic acid is sourced from PubChem (CID 86118519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).