About 4-(4-cyanobutyl)benzoic acid
4-(4-cyanobutyl)benzoic acid (PubChem CID 134098566) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(4-cyanobutyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(4-cyanobutyl)benzoic acid |
| PubChem CID | 134098566 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-(4-cyanobutyl)benzoic acid |
| SMILES | N#CCCCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H13NO2/c13-9-3-1-2-4-10-5-7-11(8-6-10)12(14)15/h5-8H,1-4H2,(H,14,15) |
| InChIKey | WGNJVNVQDMCNDI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-cyanobutyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyanobutyl)benzoic acid?
The IUPAC name of 4-(4-cyanobutyl)benzoic acid (CID 134098566) is 4-(4-cyanobutyl)benzoic acid.
What is the SMILES notation for 4-(4-cyanobutyl)benzoic acid?
The canonical SMILES for 4-(4-cyanobutyl)benzoic acid is N#CCCCCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(4-cyanobutyl)benzoic acid?
The InChIKey is WGNJVNVQDMCNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c13-9-3-1-2-4-10-5-7-11(8-6-10)12(14)15/h5-8H,1-4H2,(H,14,15).
What are the key properties of 4-(4-cyanobutyl)benzoic acid?
4-(4-cyanobutyl)benzoic acid has a molecular weight of 203.24 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyanobutyl)benzoic acid is sourced from PubChem (CID 134098566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).