5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid

C11H16O4S — CID 175271309

IUPAC5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid
SMILESC=CCC1C=CC=CC1=CC.O=S(=O)(O)O
InChIInChI=1S/C11H14.H2O4S/c1-3-7-11-9-6-5-8-10(11)4-2;1-5(2,3)4/h3-6,8-9,11H,1,7H2,2H3;(H2,1,2,3,4)
InChIKeyLHWYJCCZFDXBGB-UHFFFAOYSA-N
MW244.31 g/mol
LogP2.60
Rot. Bonds2

About 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid

5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid (PubChem CID 175271309) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid.

Molecular Properties

Compound Name5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid
PubChem CID175271309
Molecular FormulaC11H16O4S
Molecular Weight244.31 g/mol
Exact Mass244.08
IUPAC Name5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid
SMILESC=CCC1C=CC=CC1=CC.O=S(=O)(O)O
InChIInChI=1S/C11H14.H2O4S/c1-3-7-11-9-6-5-8-10(11)4-2;1-5(2,3)4/h3-6,8-9,11H,1,7H2,2H3;(H2,1,2,3,4)
InChIKeyLHWYJCCZFDXBGB-UHFFFAOYSA-N
XLogP2.60
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.31
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid?
The IUPAC name of 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid (CID 175271309) is 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid.
What is the SMILES notation for 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid?
The canonical SMILES for 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid is C=CCC1C=CC=CC1=CC.O=S(=O)(O)O.
What is the InChIKey of 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid?
The InChIKey is LHWYJCCZFDXBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.H2O4S/c1-3-7-11-9-6-5-8-10(11)4-2;1-5(2,3)4/h3-6,8-9,11H,1,7H2,2H3;(H2,1,2,3,4).
What are the key properties of 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid?
5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid has a molecular weight of 244.31 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid is sourced from PubChem (CID 175271309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).