C11H16O4S — CID 175271309
5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid (PubChem CID 175271309) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid.
| Compound Name | 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid |
|---|---|
| PubChem CID | 175271309 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-ethylidene-6-prop-2-enylcyclohexa-1,3-diene;sulfuric acid |
| SMILES | C=CCC1C=CC=CC1=CC.O=S(=O)(O)O |
| InChI | InChI=1S/C11H14.H2O4S/c1-3-7-11-9-6-5-8-10(11)4-2;1-5(2,3)4/h3-6,8-9,11H,1,7H2,2H3;(H2,1,2,3,4) |
| InChIKey | LHWYJCCZFDXBGB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|