C24H30O8 — CID 70442974
bis(6-ethylidenecyclohexa-2,4-diene-1-carboxylic acid);hexanedioic acid (PubChem CID 70442974) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is bis(6-ethylidenecyclohexa-2,4-diene-1-carboxylic acid);hexanedioic acid.
| Compound Name | bis(6-ethylidenecyclohexa-2,4-diene-1-carboxylic acid);hexanedioic acid |
|---|---|
| PubChem CID | 70442974 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | bis(6-ethylidenecyclohexa-2,4-diene-1-carboxylic acid);hexanedioic acid |
| SMILES | CC=C1C=CC=CC1C(=O)O.CC=C1C=CC=CC1C(=O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/2C9H10O2.C6H10O4/c2*1-2-7-5-3-4-6-8(7)9(10)11;7-5(8)3-1-2-4-6(9)10/h2*2-6,8H,1H3,(H,10,11);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | IRXBMTUTAUIJQA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|