C14H20NO2+ — CID 153366595
6-[4-[(E)-prop-1-enyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 153366595) has the molecular formula C14H20NO2+ and a molecular weight of 234.32 g/mol. Its IUPAC name is 6-[4-[(E)-prop-1-enyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[(E)-prop-1-enyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 153366595 |
| Molecular Formula | C14H20NO2+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-[4-[(E)-prop-1-enyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | C/C=C/c1cc[n+](CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-2-6-13-8-11-15(12-9-13)10-5-3-4-7-14(16)17/h2,6,8-9,11-12H,3-5,7,10H2,1H3/p+1/b6-2+ |
| InChIKey | OULKWKYUVXBPJA-QHHAFSJGSA-O |
| XLogP | 2.65 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|