C21H22BrIN2O2 — CID 10506632
6-(13-methyl-6,13-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaen-6-yl)hexanoic acid;bromide;iodide (PubChem CID 10506632) has the molecular formula C21H22BrIN2O2 and a molecular weight of 541.23 g/mol. Its IUPAC name is 6-(13-methyl-6,13-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaen-6-yl)hexanoic acid;bromide;iodide.
| Compound Name | 6-(13-methyl-6,13-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaen-6-yl)hexanoic acid;bromide;iodide |
|---|---|
| PubChem CID | 10506632 |
| Molecular Formula | C21H22BrIN2O2 |
| Molecular Weight | 541.23 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | 6-(13-methyl-6,13-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaen-6-yl)hexanoic acid;bromide;iodide |
| SMILES | C[n+]1cc2ccc3c[n+](CCCCCC(=O)O)cc4ccc(c1)c2c34.[Br-].[I-] |
| InChI | InChI=1S/C21H21N2O2.BrH.HI/c1-22-11-15-6-8-17-13-23(10-4-2-3-5-19(24)25)14-18-9-7-16(12-22)20(15)21(17)18;;/h6-9,11-14H,2-5,10H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | IOZWQKYHIVWZHB-UHFFFAOYSA-M |
| XLogP | -2.65 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.23 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|