C12H17NO5S — CID 22924831
1-(5-carboxypentyl)-4-methylpyridin-1-ium-3-sulfonate (PubChem CID 22924831) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-4-methylpyridin-1-ium-3-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-4-methylpyridin-1-ium-3-sulfonate |
|---|---|
| PubChem CID | 22924831 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(5-carboxypentyl)-4-methylpyridin-1-ium-3-sulfonate |
| SMILES | Cc1cc[n+](CCCCCC(=O)O)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H17NO5S/c1-10-6-8-13(9-11(10)19(16,17)18)7-4-2-3-5-12(14)15/h6,8-9H,2-5,7H2,1H3,(H-,14,15,16,17,18) |
| InChIKey | CEGRYUJRAWHRPC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|